C27H26N2 — CID 174819544
pyridine;1H-pyrrole;1,2,3,6-tetrahydrochrysene (PubChem CID 174819544) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is pyridine;1H-pyrrole;1,2,3,6-tetrahydrochrysene.
| Compound Name | pyridine;1H-pyrrole;1,2,3,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 174819544 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | pyridine;1H-pyrrole;1,2,3,6-tetrahydrochrysene |
| SMILES | C1=c2c(ccc3c2=CCc2ccccc2-3)CCC1.c1cc[nH]c1.c1ccncc1 |
| InChI | InChI=1S/C18H16.C5H5N.C4H5N/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-6-5-3-1;1-2-4-5-3-1/h1,3,5,7-8,10-12H,2,4,6,9H2;1-5H;1-5H |
| InChIKey | NXRUJJLAZDABLE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |