About phenol;pyridine;1H-pyrrole
phenol;pyridine;1H-pyrrole (PubChem CID 174869090) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is phenol;pyridine;1H-pyrrole.
Molecular Properties
| Compound Name | phenol;pyridine;1H-pyrrole |
| PubChem CID | 174869090 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | phenol;pyridine;1H-pyrrole |
| SMILES | Oc1ccccc1.c1cc[nH]c1.c1ccncc1 |
| InChI | InChI=1S/C6H6O.C5H5N.C4H5N/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;1-2-4-5-3-1/h1-5,7H;1-5H;1-5H |
| InChIKey | SFNIJBQFAYRLQT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;pyridine;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;pyridine;1H-pyrrole?
The IUPAC name of phenol;pyridine;1H-pyrrole (CID 174869090) is phenol;pyridine;1H-pyrrole.
What is the SMILES notation for phenol;pyridine;1H-pyrrole?
The canonical SMILES for phenol;pyridine;1H-pyrrole is Oc1ccccc1.c1cc[nH]c1.c1ccncc1.
What is the InChIKey of phenol;pyridine;1H-pyrrole?
The InChIKey is SFNIJBQFAYRLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C5H5N.C4H5N/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;1-2-4-5-3-1/h1-5,7H;1-5H;1-5H.
What are the key properties of phenol;pyridine;1H-pyrrole?
phenol;pyridine;1H-pyrrole has a molecular weight of 240.31 g/mol, XLogP of 3.49, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;pyridine;1H-pyrrole is sourced from PubChem (CID 174869090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).