C18H16 — CID 174255950
1,2,3,6-tetrahydrochrysene (PubChem CID 174255950) has the molecular formula C18H16 and a molecular weight of 232.33 g/mol. Its IUPAC name is 1,2,3,6-tetrahydrochrysene.
| Compound Name | 1,2,3,6-tetrahydrochrysene |
|---|---|
| PubChem CID | 174255950 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1,2,3,6-tetrahydrochrysene |
| SMILES | C1=c2c(ccc3c2=CCc2ccccc2-3)CCC1 |
| InChI | InChI=1S/C18H16/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1,3,5,7-8,10-12H,2,4,6,9H2 |
| InChIKey | LZYZLAFBFIJPDZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |