C24H24N2 — CID 175248018
1H-azepine;1,2,3,6-tetrahydrochrysen-1-amine (PubChem CID 175248018) has the molecular formula C24H24N2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1H-azepine;1,2,3,6-tetrahydrochrysen-1-amine.
| Compound Name | 1H-azepine;1,2,3,6-tetrahydrochrysen-1-amine |
|---|---|
| PubChem CID | 175248018 |
| Molecular Formula | C24H24N2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1H-azepine;1,2,3,6-tetrahydrochrysen-1-amine |
| SMILES | C1=CC=CNC=C1.NC1CCC=c2c1ccc1c2=CCc2ccccc2-1 |
| InChI | InChI=1S/C18H17N.C6H7N/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-2-4-6-7-5-3-1/h1-2,4-6,9-11,18H,3,7-8,19H2;1-7H |
| InChIKey | GMHQAUWWTXHQOY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |