C32H27Cl2NO — CID 175250893
1H-azepine;[3-(dichloromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 175250893) has the molecular formula C32H27Cl2NO and a molecular weight of 512.48 g/mol. Its IUPAC name is 1H-azepine;[3-(dichloromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | 1H-azepine;[3-(dichloromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 175250893 |
| Molecular Formula | C32H27Cl2NO |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 1H-azepine;[3-(dichloromethyl)phenyl]-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | C1=CC=CNC=C1.O=C(c1cccc(C(Cl)Cl)c1)C1C=c2c(ccc3c2=CCc2ccccc2-3)CC1 |
| InChI | InChI=1S/C26H20Cl2O.C6H7N/c27-26(28)20-6-3-5-18(14-20)25(29)19-9-8-17-11-12-22-21-7-2-1-4-16(21)10-13-23(22)24(17)15-19;1-2-4-6-7-5-3-1/h1-7,11-15,19,26H,8-10H2;1-7H |
| InChIKey | YYYBTAKCQPEMNE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|