C26H21NO3 — CID 174511667
(4-methyl-3-nitrophenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174511667) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (4-methyl-3-nitrophenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | (4-methyl-3-nitrophenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174511667 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (4-methyl-3-nitrophenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2C=c3c(ccc4c3=CCc3ccccc3-4)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21NO3/c1-16-6-7-20(15-25(16)27(29)30)26(28)19-9-8-18-11-12-22-21-5-3-2-4-17(21)10-13-23(22)24(18)14-19/h2-7,11-15,19H,8-10H2,1H3 |
| InChIKey | GFQPVYQNRCIJPN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|