C27H23NO3 — CID 174525637
(4-methyl-3-nitrophenyl)-(7-methyl-1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174525637) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (4-methyl-3-nitrophenyl)-(7-methyl-1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | (4-methyl-3-nitrophenyl)-(7-methyl-1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174525637 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (4-methyl-3-nitrophenyl)-(7-methyl-1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | Cc1ccc(C(=O)C2C=c3c(ccc4c3=CCc3c(C)cccc3-4)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H23NO3/c1-16-4-3-5-22-21(16)12-13-24-23(22)11-10-18-8-9-19(14-25(18)24)27(29)20-7-6-17(2)26(15-20)28(30)31/h3-7,10-11,13-15,19H,8-9,12H2,1-2H3 |
| InChIKey | LISPPZNTWARNPS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|