C20H17BrO — CID 174511889
1-(8-bromo-1,2,3,6-tetrahydrochrysen-3-yl)ethanone (PubChem CID 174511889) has the molecular formula C20H17BrO and a molecular weight of 353.26 g/mol. Its IUPAC name is 1-(8-bromo-1,2,3,6-tetrahydrochrysen-3-yl)ethanone.
| Compound Name | 1-(8-bromo-1,2,3,6-tetrahydrochrysen-3-yl)ethanone |
|---|---|
| PubChem CID | 174511889 |
| Molecular Formula | C20H17BrO |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-(8-bromo-1,2,3,6-tetrahydrochrysen-3-yl)ethanone |
| SMILES | CC(=O)C1C=c2c(ccc3c2=CCc2cc(Br)ccc2-3)CC1 |
| InChI | InChI=1S/C20H17BrO/c1-12(22)14-3-2-13-4-7-18-17-9-6-16(21)10-15(17)5-8-19(18)20(13)11-14/h4,6-11,14H,2-3,5H2,1H3 |
| InChIKey | NHCHFYQCJQBXHD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |