C26H22O2 — CID 174525868
(3-methoxyphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone (PubChem CID 174525868) has the molecular formula C26H22O2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (3-methoxyphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone.
| Compound Name | (3-methoxyphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
|---|---|
| PubChem CID | 174525868 |
| Molecular Formula | C26H22O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (3-methoxyphenyl)-(1,2,3,6-tetrahydrochrysen-3-yl)methanone |
| SMILES | COc1cccc(C(=O)C2C=c3c(ccc4c3=CCc3ccccc3-4)CC2)c1 |
| InChI | InChI=1S/C26H22O2/c1-28-21-7-4-6-19(15-21)26(27)20-10-9-18-12-13-23-22-8-3-2-5-17(22)11-14-24(23)25(18)16-20/h2-8,12-16,20H,9-11H2,1H3 |
| InChIKey | XRYQPIRFCDHPCO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |