C18H18O — CID 71328168
5,6,8,9,10,11-hexahydrobenzo[a]anthracen-10-ol (PubChem CID 71328168) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 5,6,8,9,10,11-hexahydrobenzo[a]anthracen-10-ol.
| Compound Name | 5,6,8,9,10,11-hexahydrobenzo[a]anthracen-10-ol |
|---|---|
| PubChem CID | 71328168 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 5,6,8,9,10,11-hexahydrobenzo[a]anthracen-10-ol |
| SMILES | OC1CCc2cc3c(cc2C1)-c1ccccc1CC3 |
| InChI | InChI=1S/C18H18O/c19-16-8-7-13-9-14-6-5-12-3-1-2-4-17(12)18(14)11-15(13)10-16/h1-4,9,11,16,19H,5-8,10H2 |
| InChIKey | BDZOESLYOGWJRA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |