C6H3Cl2NO4S — CID 141024898
1,5-dichloro-4-nitro-6-sulfonylcyclohexa-1,3-diene (PubChem CID 141024898) has the molecular formula C6H3Cl2NO4S and a molecular weight of 256.07 g/mol. Its IUPAC name is 1,5-dichloro-4-nitro-6-sulfonylcyclohexa-1,3-diene.
| Compound Name | 1,5-dichloro-4-nitro-6-sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141024898 |
| Molecular Formula | C6H3Cl2NO4S |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 254.92 |
| IUPAC Name | 1,5-dichloro-4-nitro-6-sulfonylcyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1=CC=C(Cl)C(=S(=O)=O)C1Cl |
| InChI | InChI=1S/C6H3Cl2NO4S/c7-3-1-2-4(9(10)11)5(8)6(3)14(12)13/h1-2,5H |
| InChIKey | NIABSPCOCMVQSA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|