About (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole
(2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole (PubChem CID 90222265) has the molecular formula C3H4ClN3O2
and a molecular weight of 149.54 g/mol. Its IUPAC name is (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole |
| PubChem CID | 90222265 |
| Molecular Formula | C3H4ClN3O2 |
| Molecular Weight | 149.54 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole |
| SMILES | O=[N+]([O-])C1=CN[C@@H](Cl)N1 |
| InChI | InChI=1S/C3H4ClN3O2/c4-3-5-1-2(6-3)7(8)9/h1,3,5-6H/t3-/m1/s1 |
| InChIKey | ROLLEHIMAWCJCS-GSVOUGTGSA-N |
| XLogP | -0.22 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.54 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole?
The IUPAC name of (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole (CID 90222265) is (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole.
What is the SMILES notation for (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole?
The canonical SMILES for (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole is O=[N+]([O-])C1=CN[C@@H](Cl)N1.
What is the InChIKey of (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole?
The InChIKey is ROLLEHIMAWCJCS-GSVOUGTGSA-N. The full InChI is InChI=1S/C3H4ClN3O2/c4-3-5-1-2(6-3)7(8)9/h1,3,5-6H/t3-/m1/s1.
What are the key properties of (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole?
(2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole has a molecular weight of 149.54 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-chloro-4-nitro-2,3-dihydro-1H-imidazole is sourced from PubChem (CID 90222265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).