C3H4N2O2S — CID 173057172
4-nitro-2,3-dihydro-1,3-thiazole (PubChem CID 173057172) has the molecular formula C3H4N2O2S and a molecular weight of 132.14 g/mol. Its IUPAC name is 4-nitro-2,3-dihydro-1,3-thiazole.
| Compound Name | 4-nitro-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 173057172 |
| Molecular Formula | C3H4N2O2S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.00 |
| IUPAC Name | 4-nitro-2,3-dihydro-1,3-thiazole |
| SMILES | O=[N+]([O-])C1=CSCN1 |
| InChI | InChI=1S/C3H4N2O2S/c6-5(7)3-1-8-2-4-3/h1,4H,2H2 |
| InChIKey | SIOYRFYZOPTZEB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|