About 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium
5-amino-2-nitro-3H-1,3-thiazole-2-diazonium (PubChem CID 175302544) has the molecular formula C3H4N5O2S+
and a molecular weight of 174.17 g/mol. Its IUPAC name is 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium.
Molecular Properties
| Compound Name | 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium |
| PubChem CID | 175302544 |
| Molecular Formula | C3H4N5O2S+ |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium |
| SMILES | N#[N+]C1([N+](=O)[O-])NC=C(N)S1 |
| InChI | InChI=1S/C3H3N5O2S/c4-2-1-6-3(7-5,11-2)8(9)10/h1,4-5H/p+1 |
| InChIKey | RXRMLQIPOBGYLD-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium?
The IUPAC name of 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium (CID 175302544) is 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium.
What is the SMILES notation for 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium?
The canonical SMILES for 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium is N#[N+]C1([N+](=O)[O-])NC=C(N)S1.
What is the InChIKey of 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium?
The InChIKey is RXRMLQIPOBGYLD-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H3N5O2S/c4-2-1-6-3(7-5,11-2)8(9)10/h1,4-5H/p+1.
What are the key properties of 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium?
5-amino-2-nitro-3H-1,3-thiazole-2-diazonium has a molecular weight of 174.17 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-nitro-3H-1,3-thiazole-2-diazonium is sourced from PubChem (CID 175302544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).