C5H6ClN3O2 — CID 149381350
2-chloro-4-methyl-5-nitro-1,4-dihydropyrimidine (PubChem CID 149381350) has the molecular formula C5H6ClN3O2 and a molecular weight of 175.58 g/mol. Its IUPAC name is 2-chloro-4-methyl-5-nitro-1,4-dihydropyrimidine.
| Compound Name | 2-chloro-4-methyl-5-nitro-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 149381350 |
| Molecular Formula | C5H6ClN3O2 |
| Molecular Weight | 175.58 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | 2-chloro-4-methyl-5-nitro-1,4-dihydropyrimidine |
| SMILES | CC1N=C(Cl)NC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C5H6ClN3O2/c1-3-4(9(10)11)2-7-5(6)8-3/h2-3H,1H3,(H,7,8) |
| InChIKey | YLSCEMPUKFIVAB-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.58 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|