C6H3ClNO5S- — CID 174509176
2-chloro-5-nitrobicyclo[2.2.0]hexa-1(6),2,4-triene;hydrogen sulfite (PubChem CID 174509176) has the molecular formula C6H3ClNO5S- and a molecular weight of 236.61 g/mol. Its IUPAC name is 2-chloro-5-nitrobicyclo[2.2.0]hexa-1(6),2,4-triene;hydrogen sulfite.
| Compound Name | 2-chloro-5-nitrobicyclo[2.2.0]hexa-1(6),2,4-triene;hydrogen sulfite |
|---|---|
| PubChem CID | 174509176 |
| Molecular Formula | C6H3ClNO5S- |
| Molecular Weight | 236.61 g/mol |
| Exact Mass | 235.94 |
| IUPAC Name | 2-chloro-5-nitrobicyclo[2.2.0]hexa-1(6),2,4-triene;hydrogen sulfite |
| SMILES | O=S([O-])O.O=[N+]([O-])c1cc2c(Cl)cc1-2 |
| InChI | InChI=1S/C6H2ClNO2.H2O3S/c7-5-1-4-3(5)2-6(4)8(9)10;1-4(2)3/h1-2H;(H2,1,2,3)/p-1 |
| InChIKey | FOTVUZCCUPODSF-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|