C10H14N2O6 — CID 142538346
3-tert-butyl-3,5-dinitrocyclohexa-1,5-diene-1,4-diol (PubChem CID 142538346) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is 3-tert-butyl-3,5-dinitrocyclohexa-1,5-diene-1,4-diol.
| Compound Name | 3-tert-butyl-3,5-dinitrocyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 142538346 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-tert-butyl-3,5-dinitrocyclohexa-1,5-diene-1,4-diol |
| SMILES | CC(C)(C)C1([N+](=O)[O-])C=C(O)C=C([N+](=O)[O-])C1O |
| InChI | InChI=1S/C10H14N2O6/c1-9(2,3)10(12(17)18)5-6(13)4-7(8(10)14)11(15)16/h4-5,8,13-14H,1-3H3 |
| InChIKey | WAPOGZXKWMBWAM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|