C9H12N2O3 — CID 159389626
3-(2-aminopropan-2-yl)-5-nitrophenol (PubChem CID 159389626) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-(2-aminopropan-2-yl)-5-nitrophenol.
| Compound Name | 3-(2-aminopropan-2-yl)-5-nitrophenol |
|---|---|
| PubChem CID | 159389626 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 3-(2-aminopropan-2-yl)-5-nitrophenol |
| SMILES | CC(C)(N)c1cc(O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H12N2O3/c1-9(2,10)6-3-7(11(13)14)5-8(12)4-6/h3-5,12H,10H2,1-2H3 |
| InChIKey | LLYFXNHDIOHOFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|