C8H3Cl6NO2 — CID 629531
1-nitro-3,5-bis(trichloromethyl)benzene (PubChem CID 629531) has the molecular formula C8H3Cl6NO2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-nitro-3,5-bis(trichloromethyl)benzene.
| Compound Name | 1-nitro-3,5-bis(trichloromethyl)benzene |
|---|---|
| PubChem CID | 629531 |
| Molecular Formula | C8H3Cl6NO2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 354.83 |
| IUPAC Name | 1-nitro-3,5-bis(trichloromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(C(Cl)(Cl)Cl)cc(C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C8H3Cl6NO2/c9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)15(16)17/h1-3H |
| InChIKey | HLKVXLAXMFMARO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|