C13H5Cl3F3NO2 — CID 134630365
1,3,5-trichloro-2-[3-nitro-5-(trifluoromethyl)phenyl]benzene (PubChem CID 134630365) has the molecular formula C13H5Cl3F3NO2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1,3,5-trichloro-2-[3-nitro-5-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,3,5-trichloro-2-[3-nitro-5-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134630365 |
| Molecular Formula | C13H5Cl3F3NO2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | 1,3,5-trichloro-2-[3-nitro-5-(trifluoromethyl)phenyl]benzene |
| SMILES | O=[N+]([O-])c1cc(-c2c(Cl)cc(Cl)cc2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H5Cl3F3NO2/c14-8-4-10(15)12(11(16)5-8)6-1-7(13(17,18)19)3-9(2-6)20(21)22/h1-5H |
| InChIKey | UVIVWUXQGDYNIT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|