C12H11F3N2O2 — CID 66802126
4-[3-nitro-5-(trifluoromethyl)phenyl]-1,2,3,6-tetrahydropyridine (PubChem CID 66802126) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 4-[3-nitro-5-(trifluoromethyl)phenyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[3-nitro-5-(trifluoromethyl)phenyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 66802126 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-[3-nitro-5-(trifluoromethyl)phenyl]-1,2,3,6-tetrahydropyridine |
| SMILES | O=[N+]([O-])c1cc(C2=CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N2O2/c13-12(14,15)10-5-9(6-11(7-10)17(18)19)8-1-3-16-4-2-8/h1,5-7,16H,2-4H2 |
| InChIKey | CLFOMZQFVDJZPV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|