C13H16N2O2 — CID 171834653
5-(2-methyl-4-nitrophenyl)-2,3,4,7-tetrahydro-1H-azepine (PubChem CID 171834653) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-(2-methyl-4-nitrophenyl)-2,3,4,7-tetrahydro-1H-azepine.
| Compound Name | 5-(2-methyl-4-nitrophenyl)-2,3,4,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 171834653 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-(2-methyl-4-nitrophenyl)-2,3,4,7-tetrahydro-1H-azepine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1C1=CCNCCC1 |
| InChI | InChI=1S/C13H16N2O2/c1-10-9-12(15(16)17)4-5-13(10)11-3-2-7-14-8-6-11/h4-6,9,14H,2-3,7-8H2,1H3 |
| InChIKey | QFTNJVVHHMKULY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|