C13H16N2O3 — CID 168896943
4-(2-ethoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 168896943) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-(2-ethoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2-ethoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 168896943 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-(2-ethoxy-4-nitrophenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | CCOc1cc([N+](=O)[O-])ccc1C1=CCNCC1 |
| InChI | InChI=1S/C13H16N2O3/c1-2-18-13-9-11(15(16)17)3-4-12(13)10-5-7-14-8-6-10/h3-5,9,14H,2,6-8H2,1H3 |
| InChIKey | LQUZJOUYVACOJK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|