C16H5F12NO2 — CID 4077912
1-[3,5-bis(trifluoromethyl)phenyl]-2-nitro-3,5-bis(trifluoromethyl)benzene (PubChem CID 4077912) has the molecular formula C16H5F12NO2 and a molecular weight of 471.20 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-2-nitro-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-nitro-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 4077912 |
| Molecular Formula | C16H5F12NO2 |
| Molecular Weight | 471.20 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-2-nitro-3,5-bis(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C16H5F12NO2/c17-13(18,19)7-1-6(2-8(3-7)14(20,21)22)10-4-9(15(23,24)25)5-11(16(26,27)28)12(10)29(30)31/h1-5H |
| InChIKey | ADFNFXRPIJQCMO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.20 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|