About 2,6-dichloro-4-nitroaniline;molecular chlorine
2,6-dichloro-4-nitroaniline;molecular chlorine (PubChem CID 20849384) has the molecular formula C6H4Cl4N2O2
and a molecular weight of 277.92 g/mol. Its IUPAC name is 2,6-dichloro-4-nitroaniline;molecular chlorine.
Molecular Properties
| Compound Name | 2,6-dichloro-4-nitroaniline;molecular chlorine |
| PubChem CID | 20849384 |
| Molecular Formula | C6H4Cl4N2O2 |
| Molecular Weight | 277.92 g/mol |
| Exact Mass | 275.90 |
| IUPAC Name | 2,6-dichloro-4-nitroaniline;molecular chlorine |
| SMILES | ClCl.Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C6H4Cl2N2O2.Cl2/c7-4-1-3(10(11)12)2-5(8)6(4)9;1-2/h1-2H,9H2; |
| InChIKey | WYFBFQVQWJOPHB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-nitroaniline;molecular chlorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-nitroaniline;molecular chlorine?
The IUPAC name of 2,6-dichloro-4-nitroaniline;molecular chlorine (CID 20849384) is 2,6-dichloro-4-nitroaniline;molecular chlorine.
What is the SMILES notation for 2,6-dichloro-4-nitroaniline;molecular chlorine?
The canonical SMILES for 2,6-dichloro-4-nitroaniline;molecular chlorine is ClCl.Nc1c(Cl)cc([N+](=O)[O-])cc1Cl.
What is the InChIKey of 2,6-dichloro-4-nitroaniline;molecular chlorine?
The InChIKey is WYFBFQVQWJOPHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2N2O2.Cl2/c7-4-1-3(10(11)12)2-5(8)6(4)9;1-2/h1-2H,9H2;.
What are the key properties of 2,6-dichloro-4-nitroaniline;molecular chlorine?
2,6-dichloro-4-nitroaniline;molecular chlorine has a molecular weight of 277.92 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-nitroaniline;molecular chlorine is sourced from PubChem (CID 20849384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).