About 3-ethynyl-5-nitrophenol
3-ethynyl-5-nitrophenol (PubChem CID 167740962) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is 3-ethynyl-5-nitrophenol.
Molecular Properties
| Compound Name | 3-ethynyl-5-nitrophenol |
| PubChem CID | 167740962 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 3-ethynyl-5-nitrophenol |
| SMILES | C#Cc1cc(O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H5NO3/c1-2-6-3-7(9(11)12)5-8(10)4-6/h1,3-5,10H |
| InChIKey | KYXIUNMGATYUPM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-5-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-5-nitrophenol?
The IUPAC name of 3-ethynyl-5-nitrophenol (CID 167740962) is 3-ethynyl-5-nitrophenol.
What is the SMILES notation for 3-ethynyl-5-nitrophenol?
The canonical SMILES for 3-ethynyl-5-nitrophenol is C#Cc1cc(O)cc([N+](=O)[O-])c1.
What is the InChIKey of 3-ethynyl-5-nitrophenol?
The InChIKey is KYXIUNMGATYUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c1-2-6-3-7(9(11)12)5-8(10)4-6/h1,3-5,10H.
What are the key properties of 3-ethynyl-5-nitrophenol?
3-ethynyl-5-nitrophenol has a molecular weight of 163.13 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-5-nitrophenol is sourced from PubChem (CID 167740962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).