C7H7F3N2O2 — CID 67942431
(6S)-4-(difluoromethyl)-6-fluoro-6-nitrocyclohexa-2,4-dien-1-amine (PubChem CID 67942431) has the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. Its IUPAC name is (6S)-4-(difluoromethyl)-6-fluoro-6-nitrocyclohexa-2,4-dien-1-amine.
| Compound Name | (6S)-4-(difluoromethyl)-6-fluoro-6-nitrocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67942431 |
| Molecular Formula | C7H7F3N2O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (6S)-4-(difluoromethyl)-6-fluoro-6-nitrocyclohexa-2,4-dien-1-amine |
| SMILES | NC1C=CC(C(F)F)=C[C@@]1(F)[N+](=O)[O-] |
| InChI | InChI=1S/C7H7F3N2O2/c8-6(9)4-1-2-5(11)7(10,3-4)12(13)14/h1-3,5-6H,11H2/t5?,7-/m1/s1 |
| InChIKey | IGARKWADXVXMKH-NQPNHJOESA-N |
| XLogP | 1.02 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|