C7H6N4O4 — CID 151504306
6-amino-1,3-dinitrocyclohexa-2,4-diene-1-carbonitrile (PubChem CID 151504306) has the molecular formula C7H6N4O4 and a molecular weight of 210.15 g/mol. Its IUPAC name is 6-amino-1,3-dinitrocyclohexa-2,4-diene-1-carbonitrile.
| Compound Name | 6-amino-1,3-dinitrocyclohexa-2,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 151504306 |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 6-amino-1,3-dinitrocyclohexa-2,4-diene-1-carbonitrile |
| SMILES | N#CC1([N+](=O)[O-])C=C([N+](=O)[O-])C=CC1N |
| InChI | InChI=1S/C7H6N4O4/c8-4-7(11(14)15)3-5(10(12)13)1-2-6(7)9/h1-3,6H,9H2 |
| InChIKey | PRCASRCSNGOBTE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 136.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|