C9H7N3O2 — CID 163566117
1-methyl-4-nitrocyclohexa-2,4-diene-1,2-dicarbonitrile (PubChem CID 163566117) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 1-methyl-4-nitrocyclohexa-2,4-diene-1,2-dicarbonitrile.
| Compound Name | 1-methyl-4-nitrocyclohexa-2,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 163566117 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 1-methyl-4-nitrocyclohexa-2,4-diene-1,2-dicarbonitrile |
| SMILES | CC1(C#N)CC=C([N+](=O)[O-])C=C1C#N |
| InChI | InChI=1S/C9H7N3O2/c1-9(6-11)3-2-8(12(13)14)4-7(9)5-10/h2,4H,3H2,1H3 |
| InChIKey | FVIQWBZKRCFJGR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|