C7H6N2O5 — CID 10465353
6-methyl-4-nitro-6-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,4-dien-1-one (PubChem CID 10465353) has the molecular formula C7H6N2O5 and a molecular weight of 199.13 g/mol. Its IUPAC name is 6-methyl-4-nitro-6-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 6-methyl-4-nitro-6-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10465353 |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 6-methyl-4-nitro-6-[oxido(oxo)(15N)(15N)azaniumyl]cyclohexa-2,4-dien-1-one |
| SMILES | CC1([15N+](=O)[O-])C=C([N+](=O)[O-])C=CC1=O |
| InChI | InChI=1S/C7H6N2O5/c1-7(9(13)14)4-5(8(11)12)2-3-6(7)10/h2-4H,1H3/i9+1 |
| InChIKey | RFCFVQUJZILIOM-QBZHADDCSA-N |
| XLogP | 0.32 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|