C24H14Cl4N4O8S — CID 150180566
2-chloro-1-[1-chloro-6-[6-chloro-6-(2-chloro-4-nitrophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]sulfanyl-3-nitrocyclohexa-2,4-dien-1-yl]-4-nitrobenzene (PubChem CID 150180566) has the molecular formula C24H14Cl4N4O8S and a molecular weight of 660.28 g/mol. Its IUPAC name is 2-chloro-1-[1-chloro-6-[6-chloro-6-(2-chloro-4-nitrophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]sulfanyl-3-nitrocyclohexa-2,4-dien-1-yl]-4-nitrobenzene.
| Compound Name | 2-chloro-1-[1-chloro-6-[6-chloro-6-(2-chloro-4-nitrophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]sulfanyl-3-nitrocyclohexa-2,4-dien-1-yl]-4-nitrobenzene |
|---|---|
| PubChem CID | 150180566 |
| Molecular Formula | C24H14Cl4N4O8S |
| Molecular Weight | 660.28 g/mol |
| Exact Mass | 657.93 |
| IUPAC Name | 2-chloro-1-[1-chloro-6-[6-chloro-6-(2-chloro-4-nitrophenyl)-4-nitrocyclohexa-2,4-dien-1-yl]sulfanyl-3-nitrocyclohexa-2,4-dien-1-yl]-4-nitrobenzene |
| SMILES | O=[N+]([O-])C1=CC(Cl)(c2ccc([N+](=O)[O-])cc2Cl)C(SC2C=CC([N+](=O)[O-])=CC2(Cl)c2ccc([N+](=O)[O-])cc2Cl)C=C1 |
| InChI | InChI=1S/C24H14Cl4N4O8S/c25-19-9-13(29(33)34)1-5-17(19)23(27)11-15(31(37)38)3-7-21(23)41-22-8-4-16(32(39)40)12-24(22,28)18-6-2-14(30(35)36)10-20(18)26/h1-12,21-22H |
| InChIKey | FLIJXEPJQIYDKU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.28 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|