C9H3ClF7NO2 — CID 11515363
2-chloro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-nitrobenzene (PubChem CID 11515363) has the molecular formula C9H3ClF7NO2 and a molecular weight of 325.57 g/mol. Its IUPAC name is 2-chloro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-nitrobenzene.
| Compound Name | 2-chloro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-nitrobenzene |
|---|---|
| PubChem CID | 11515363 |
| Molecular Formula | C9H3ClF7NO2 |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 2-chloro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(C(F)(C(F)(F)F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H3ClF7NO2/c10-6-3-4(18(19)20)1-2-5(6)7(11,8(12,13)14)9(15,16)17/h1-3H |
| InChIKey | PVHPKWIIBALBLW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|