C22H10Cl2F16N2O5 — CID 88598630
2-chloro-1-[5-[5-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5-octafluoropentoxy]-1,1,2,2,3,3,4,4-octafluoropentyl]-4-nitrobenzene (PubChem CID 88598630) has the molecular formula C22H10Cl2F16N2O5 and a molecular weight of 757.20 g/mol. Its IUPAC name is 2-chloro-1-[5-[5-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5-octafluoropentoxy]-1,1,2,2,3,3,4,4-octafluoropentyl]-4-nitrobenzene.
| Compound Name | 2-chloro-1-[5-[5-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5-octafluoropentoxy]-1,1,2,2,3,3,4,4-octafluoropentyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 88598630 |
| Molecular Formula | C22H10Cl2F16N2O5 |
| Molecular Weight | 757.20 g/mol |
| Exact Mass | 755.97 |
| IUPAC Name | 2-chloro-1-[5-[5-(2-chloro-4-nitrophenyl)-2,2,3,3,4,4,5,5-octafluoropentoxy]-1,1,2,2,3,3,4,4-octafluoropentyl]-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)c2ccc([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H10Cl2F16N2O5/c23-13-5-9(41(43)44)1-3-11(13)17(29,30)21(37,38)19(33,34)15(25,26)7-47-8-16(27,28)20(35,36)22(39,40)18(31,32)12-4-2-10(42(45)46)6-14(12)24/h1-6H,7-8H2 |
| InChIKey | JUODTBZBOIBANQ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.20 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|