C24H14Cl6N2O4S — CID 150576193
1,2,6-trichloro-6-(3-nitrophenyl)-5-[4,5,6-trichloro-6-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]sulfanylcyclohexa-1,3-diene (PubChem CID 150576193) has the molecular formula C24H14Cl6N2O4S and a molecular weight of 639.17 g/mol. Its IUPAC name is 1,2,6-trichloro-6-(3-nitrophenyl)-5-[4,5,6-trichloro-6-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]sulfanylcyclohexa-1,3-diene.
| Compound Name | 1,2,6-trichloro-6-(3-nitrophenyl)-5-[4,5,6-trichloro-6-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]sulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 150576193 |
| Molecular Formula | C24H14Cl6N2O4S |
| Molecular Weight | 639.17 g/mol |
| Exact Mass | 635.88 |
| IUPAC Name | 1,2,6-trichloro-6-(3-nitrophenyl)-5-[4,5,6-trichloro-6-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]sulfanylcyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])c1cccc(C2(Cl)C(Cl)=C(Cl)C=CC2SC2C=CC(Cl)=C(Cl)C2(Cl)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H14Cl6N2O4S/c25-17-7-9-19(23(29,21(17)27)13-3-1-5-15(11-13)31(33)34)37-20-10-8-18(26)22(28)24(20,30)14-4-2-6-16(12-14)32(35)36/h1-12,19-20H |
| InChIKey | IMWFVQPIUQOESS-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.17 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|