C16H21N5O4 — CID 66572942
1,3,6,8-tetramethyl-8a-(3-nitrophenyl)-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione (PubChem CID 66572942) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1,3,6,8-tetramethyl-8a-(3-nitrophenyl)-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 1,3,6,8-tetramethyl-8a-(3-nitrophenyl)-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 66572942 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1,3,6,8-tetramethyl-8a-(3-nitrophenyl)-4a,5-dihydro-4H-pyrimido[4,5-d]pyrimidine-2,7-dione |
| SMILES | CN1CC2CN(C)C(=O)N(C)C2(c2cccc([N+](=O)[O-])c2)N(C)C1=O |
| InChI | InChI=1S/C16H21N5O4/c1-17-9-12-10-18(2)15(23)20(4)16(12,19(3)14(17)22)11-6-5-7-13(8-11)21(24)25/h5-8,12H,9-10H2,1-4H3 |
| InChIKey | OZVGZKLEQAPCGI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 90.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|