C15H19N3O3 — CID 58082851
(6R)-2,3,5,5,6-pentamethyl-6-(3-nitrophenyl)pyrimidin-4-one (PubChem CID 58082851) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (6R)-2,3,5,5,6-pentamethyl-6-(3-nitrophenyl)pyrimidin-4-one.
| Compound Name | (6R)-2,3,5,5,6-pentamethyl-6-(3-nitrophenyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 58082851 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (6R)-2,3,5,5,6-pentamethyl-6-(3-nitrophenyl)pyrimidin-4-one |
| SMILES | CC1=N[C@](C)(c2cccc([N+](=O)[O-])c2)C(C)(C)C(=O)N1C |
| InChI | InChI=1S/C15H19N3O3/c1-10-16-15(4,14(2,3)13(19)17(10)5)11-7-6-8-12(9-11)18(20)21/h6-9H,1-5H3/t15-/m1/s1 |
| InChIKey | KCHASPHHBGNKDL-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|