C21H22N4O5 — CID 139271356
tert-butyl N-[1-methyl-4-(3-nitrophenyl)-5-oxo-4-phenylimidazol-2-yl]carbamate (PubChem CID 139271356) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is tert-butyl N-[1-methyl-4-(3-nitrophenyl)-5-oxo-4-phenylimidazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-methyl-4-(3-nitrophenyl)-5-oxo-4-phenylimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 139271356 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | tert-butyl N-[1-methyl-4-(3-nitrophenyl)-5-oxo-4-phenylimidazol-2-yl]carbamate |
| SMILES | CN1C(=O)C(c2ccccc2)(c2cccc([N+](=O)[O-])c2)N=C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H22N4O5/c1-20(2,3)30-19(27)22-18-23-21(17(26)24(18)4,14-9-6-5-7-10-14)15-11-8-12-16(13-15)25(28)29/h5-13H,1-4H3,(H,22,23,27) |
| InChIKey | PKTWLAAXLHCNLZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|