C8H10N2O4 — CID 172840390
4-amino-6-methyl-6-nitrocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 172840390) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 4-amino-6-methyl-6-nitrocyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-amino-6-methyl-6-nitrocyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 172840390 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 4-amino-6-methyl-6-nitrocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1([N+](=O)[O-])C=C(N)C=CC1C(=O)O |
| InChI | InChI=1S/C8H10N2O4/c1-8(10(13)14)4-5(9)2-3-6(8)7(11)12/h2-4,6H,9H2,1H3,(H,11,12) |
| InChIKey | WSEYUHYAJKVHQB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|