C6H4FNO3 — CID 45090652
6-fluoro-6-nitrocyclohexa-2,4-dien-1-one (PubChem CID 45090652) has the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. Its IUPAC name is 6-fluoro-6-nitrocyclohexa-2,4-dien-1-one.
| Compound Name | 6-fluoro-6-nitrocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 45090652 |
| Molecular Formula | C6H4FNO3 |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 6-fluoro-6-nitrocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1(F)[N+](=O)[O-] |
| InChI | InChI=1S/C6H4FNO3/c7-6(8(10)11)4-2-1-3-5(6)9/h1-4H |
| InChIKey | PZAGWKZWFYRTGD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|