C10H12O2 — CID 102426540
3-[(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl]propanal (PubChem CID 102426540) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-[(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl]propanal.
| Compound Name | 3-[(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl]propanal |
|---|---|
| PubChem CID | 102426540 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-[(1S)-1-methyl-6-oxocyclohexa-2,4-dien-1-yl]propanal |
| SMILES | C[C@]1(CCC=O)C=CC=CC1=O |
| InChI | InChI=1S/C10H12O2/c1-10(7-4-8-11)6-3-2-5-9(10)12/h2-3,5-6,8H,4,7H2,1H3/t10-/m1/s1 |
| InChIKey | NLDMOOGRYXJKHH-SNVBAGLBSA-N |
| XLogP | 1.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|