C12H16O2 — CID 13237588
3-(1,3,5-trimethyl-6-oxocyclohexa-2,4-dien-1-yl)propanal (PubChem CID 13237588) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(1,3,5-trimethyl-6-oxocyclohexa-2,4-dien-1-yl)propanal.
| Compound Name | 3-(1,3,5-trimethyl-6-oxocyclohexa-2,4-dien-1-yl)propanal |
|---|---|
| PubChem CID | 13237588 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-(1,3,5-trimethyl-6-oxocyclohexa-2,4-dien-1-yl)propanal |
| SMILES | CC1=CC(C)(CCC=O)C(=O)C(C)=C1 |
| InChI | InChI=1S/C12H16O2/c1-9-7-10(2)11(14)12(3,8-9)5-4-6-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | UHYUQZNUXXQBHZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|