C19H28O — CID 177412963
6-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trimethylcyclohexa-2,4-dien-1-one (PubChem CID 177412963) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 6-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trimethylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trimethylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 177412963 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 6-[(2Z)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trimethylcyclohexa-2,4-dien-1-one |
| SMILES | CC(C)=CCC/C(C)=C\CC1(C)C=C(C)C=C(C)C1=O |
| InChI | InChI=1S/C19H28O/c1-14(2)8-7-9-15(3)10-11-19(6)13-16(4)12-17(5)18(19)20/h8,10,12-13H,7,9,11H2,1-6H3/b15-10- |
| InChIKey | FFNLVNFBDJYMOC-GDNBJRDFSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|