C29H40O4 — CID 11798003
(1S,8R)-4,5-dimethoxy-2-methyl-7-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 11798003) has the molecular formula C29H40O4 and a molecular weight of 454.62 g/mol. Its IUPAC name is (1S,8R)-4,5-dimethoxy-2-methyl-7-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,8R)-4,5-dimethoxy-2-methyl-7-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 11798003 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | (1S,8R)-4,5-dimethoxy-2-methyl-7-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | COC1=C(OC)C(=O)[13C]2(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H]3C=C[C@H](C3)[13C]2(C)C1=O |
| InChI | InChI=1S/C29H40O4/c1-19(2)10-8-11-20(3)12-9-13-21(4)16-17-29-23-15-14-22(18-23)28(29,5)26(30)24(32-6)25(33-7)27(29)31/h10,12,14-16,22-23H,8-9,11,13,17-18H2,1-7H3/b20-12+,21-16+/t22-,23+,28?,29?/m1/s1/i28+1,29+1 |
| InChIKey | QVWKOJHTBSCTTG-ILFJBFGWSA-N |
| XLogP | 6.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|