C34H42O6 — CID 163045828
1-(3,7-dimethylocta-2,6-dienyl)-3,8-dihydroxy-6-methoxy-1,5-bis(3-methylbut-2-enyl)xanthene-2,9-dione (PubChem CID 163045828) has the molecular formula C34H42O6 and a molecular weight of 546.70 g/mol. Its IUPAC name is 1-(3,7-dimethylocta-2,6-dienyl)-3,8-dihydroxy-6-methoxy-1,5-bis(3-methylbut-2-enyl)xanthene-2,9-dione.
| Compound Name | 1-(3,7-dimethylocta-2,6-dienyl)-3,8-dihydroxy-6-methoxy-1,5-bis(3-methylbut-2-enyl)xanthene-2,9-dione |
|---|---|
| PubChem CID | 163045828 |
| Molecular Formula | C34H42O6 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 1-(3,7-dimethylocta-2,6-dienyl)-3,8-dihydroxy-6-methoxy-1,5-bis(3-methylbut-2-enyl)xanthene-2,9-dione |
| SMILES | COc1cc(O)c2c(=O)c3c(oc2c1CC=C(C)C)C=C(O)C(=O)C3(CC=C(C)C)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C34H42O6/c1-20(2)10-9-11-23(7)15-17-34(16-14-22(5)6)30-28(19-26(36)33(34)38)40-32-24(13-12-21(3)4)27(39-8)18-25(35)29(32)31(30)37/h10,12,14-15,18-19,35-36H,9,11,13,16-17H2,1-8H3 |
| InChIKey | FJLWRWKTILQEIK-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|