C34H54O4 — CID 70392869
4,5-dimethoxy-2-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 70392869) has the molecular formula C34H54O4 and a molecular weight of 526.80 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | 4,5-dimethoxy-2-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 70392869 |
| Molecular Formula | C34H54O4 |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | 4,5-dimethoxy-2-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | COC1=C(OC)C(=O)C2(C/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)C3C=CC(C3)C2(C)C1=O |
| InChI | InChI=1S/C34H54O4/c1-23(2)12-9-13-24(3)14-10-15-25(4)16-11-17-26(5)20-21-34-28-19-18-27(22-28)33(34,6)31(35)29(37-7)30(38-8)32(34)36/h18-20,23-25,27-28H,9-17,21-22H2,1-8H3/b26-20+ |
| InChIKey | QCZLLGSXGPOYLK-LHLOQNFPSA-N |
| XLogP | 8.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|