C26H42O2 — CID 54536347
2-(3,7,11,15-tetramethylhexadec-2-enyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 54536347) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-(3,7,11,15-tetramethylhexadec-2-enyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3,7,11,15-tetramethylhexadec-2-enyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 54536347 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 2-(3,7,11,15-tetramethylhexadec-2-enyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(=CCC1=CC(=O)C=CC1=O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H42O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)15-16-24-19-25(27)17-18-26(24)28/h15,17-22H,6-14,16H2,1-5H3 |
| InChIKey | ZAAYXWYMKQDIIG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|