C28H48O2 — CID 70000983
2-ethyl-6-(3,7,11,15-tetramethylhexadec-2-enyl)benzene-1,4-diol (PubChem CID 70000983) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is 2-ethyl-6-(3,7,11,15-tetramethylhexadec-2-enyl)benzene-1,4-diol.
| Compound Name | 2-ethyl-6-(3,7,11,15-tetramethylhexadec-2-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 70000983 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | 2-ethyl-6-(3,7,11,15-tetramethylhexadec-2-enyl)benzene-1,4-diol |
| SMILES | CCc1cc(O)cc(CC=C(C)CCCC(C)CCCC(C)CCCC(C)C)c1O |
| InChI | InChI=1S/C28H48O2/c1-7-25-19-27(29)20-26(28(25)30)18-17-24(6)16-10-15-23(5)14-9-13-22(4)12-8-11-21(2)3/h17,19-23,29-30H,7-16,18H2,1-6H3 |
| InChIKey | KTJUWPKGZKFLAB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|