C12H17O — CID 11229107
CID 11229107 (PubChem CID 11229107) has the molecular formula C12H17O and a molecular weight of 177.27 g/mol.
| Compound Name | CID 11229107 |
|---|---|
| PubChem CID | 11229107 |
| Molecular Formula | C12H17O |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | — |
| SMILES | CC(C)=CCCC1(C)C=CC=C1[O] |
| InChI | InChI=1S/C12H17O/c1-10(2)6-4-8-12(3)9-5-7-11(12)13/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | PMGAIGZXGDXVKN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 19.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|