C6H4FIO — CID 175573997
6-fluoro-6-iodocyclohexa-2,4-dien-1-one (PubChem CID 175573997) has the molecular formula C6H4FIO and a molecular weight of 238.00 g/mol. Its IUPAC name is 6-fluoro-6-iodocyclohexa-2,4-dien-1-one.
| Compound Name | 6-fluoro-6-iodocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 175573997 |
| Molecular Formula | C6H4FIO |
| Molecular Weight | 238.00 g/mol |
| Exact Mass | 237.93 |
| IUPAC Name | 6-fluoro-6-iodocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1(F)I |
| InChI | InChI=1S/C6H4FIO/c7-6(8)4-2-1-3-5(6)9/h1-4H |
| InChIKey | XWMKKHWFTRODDB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.00 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|