C10H13FO — CID 12969847
4-tert-butyl-4-fluorocyclohexa-2,5-dien-1-one (PubChem CID 12969847) has the molecular formula C10H13FO and a molecular weight of 168.21 g/mol. Its IUPAC name is 4-tert-butyl-4-fluorocyclohexa-2,5-dien-1-one.
| Compound Name | 4-tert-butyl-4-fluorocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 12969847 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-tert-butyl-4-fluorocyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1(F)C=CC(=O)C=C1 |
| InChI | InChI=1S/C10H13FO/c1-9(2,3)10(11)6-4-8(12)5-7-10/h4-7H,1-3H3 |
| InChIKey | YMRQPKUGJLCYRZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |